C18H17NO8 — CID 91285706
(2,3-dihydroxyphenyl) (2R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxypropanoate (PubChem CID 91285706) has the molecular formula C18H17NO8 and a molecular weight of 375.33 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl) (2R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxypropanoate.
| Compound Name | (2,3-dihydroxyphenyl) (2R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 91285706 |
| Molecular Formula | C18H17NO8 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (2,3-dihydroxyphenyl) (2R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxypropanoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)NC[C@@H](O)C(=O)Oc1cccc(O)c1O |
| InChI | InChI=1S/C18H17NO8/c20-11-6-4-10(8-13(11)22)5-7-16(24)19-9-14(23)18(26)27-15-3-1-2-12(21)17(15)25/h1-8,14,20-23,25H,9H2,(H,19,24)/t14-/m1/s1 |
| InChIKey | SDBVJSLHFPIEGW-CQSZACIVSA-N |
| XLogP | 0.60 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|