C17H16ClN3O2 — CID 39580126
N-[2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 39580126) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is N-[2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39580126 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[2-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-15-6-3-13(4-7-15)5-8-16(22)20-10-11-21-17(23)14-2-1-9-19-12-14/h1-9,12H,10-11H2,(H,20,22)(H,21,23)/b8-5+ |
| InChIKey | DXTVLYNDALFTKC-VMPITWQZSA-N |
| XLogP | 2.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|