C13H13ClN4O2 — CID 39578256
N-[2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]ethyl]pyridine-3-carboxamide (PubChem CID 39578256) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is N-[2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39578256 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-[2-[(4-chloro-1H-pyrrole-2-carbonyl)amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc(Cl)c[nH]1)c1cccnc1 |
| InChI | InChI=1S/C13H13ClN4O2/c14-10-6-11(18-8-10)13(20)17-5-4-16-12(19)9-2-1-3-15-7-9/h1-3,6-8,18H,4-5H2,(H,16,19)(H,17,20) |
| InChIKey | IBZLNPFBXFVJGS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|