C17H23ClN4O3 — CID 74380821
3-[5-chloro-6-[[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 74380821) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is 3-[5-chloro-6-[[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[5-chloro-6-[[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74380821 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-[5-chloro-6-[[3-(4-methylpiperidin-1-yl)-3-oxopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | CC1CCN(C(=O)CCNc2ncc(C=CC(=O)NO)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClN4O3/c1-12-5-8-22(9-6-12)16(24)4-7-19-17-14(18)10-13(11-20-17)2-3-15(23)21-25/h2-3,10-12,25H,4-9H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | HLMGAEHWNAKYRG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|