C14H14Cl2N4OS — CID 55735708
(E)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 55735708) has the molecular formula C14H14Cl2N4OS and a molecular weight of 357.27 g/mol. Its IUPAC name is (E)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55735708 |
| Molecular Formula | C14H14Cl2N4OS |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (E)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)NCCNc2ncc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C14H14Cl2N4OS/c1-9-20-11(8-22-9)2-3-13(21)17-4-5-18-14-12(16)6-10(15)7-19-14/h2-3,6-8H,4-5H2,1H3,(H,17,21)(H,18,19)/b3-2+ |
| InChIKey | WBKJQJPEXNFUHR-NSCUHMNNSA-N |
| XLogP | 3.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|