C14H18Cl2N2O4 — CID 150355605
tert-butyl N-[2-[2-(3,5-dichloro-2-pyridinyl)-2-oxoethoxy]ethyl]carbamate (PubChem CID 150355605) has the molecular formula C14H18Cl2N2O4 and a molecular weight of 349.21 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3,5-dichloro-2-pyridinyl)-2-oxoethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3,5-dichloro-2-pyridinyl)-2-oxoethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 150355605 |
| Molecular Formula | C14H18Cl2N2O4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | tert-butyl N-[2-[2-(3,5-dichloro-2-pyridinyl)-2-oxoethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCC(=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O4/c1-14(2,3)22-13(20)17-4-5-21-8-11(19)12-10(16)6-9(15)7-18-12/h6-7H,4-5,8H2,1-3H3,(H,17,20) |
| InChIKey | GUQOZYKTXHHFLZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|