C16H24Cl2IN7 — CID 111953140
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111953140) has the molecular formula C16H24Cl2IN7 and a molecular weight of 512.23 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111953140 |
| Molecular Formula | C16H24Cl2IN7 |
| Molecular Weight | 512.23 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncc(Cl)cc1Cl)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C16H23Cl2N7.HI/c1-10-13(11(2)25(4)24-10)9-23-16(19-3)21-6-5-20-15-14(18)7-12(17)8-22-15;/h7-8H,5-6,9H2,1-4H3,(H,20,22)(H2,19,21,23);1H |
| InChIKey | QEJSZULIWMSURM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|