C15H18Cl2N6 — CID 110969024
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110969024) has the molecular formula C15H18Cl2N6 and a molecular weight of 353.26 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110969024 |
| Molecular Formula | C15H18Cl2N6 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCNc1ncc(Cl)cc1Cl)NCc1ccccn1 |
| InChI | InChI=1S/C15H18Cl2N6/c1-18-15(23-10-12-4-2-3-5-19-12)21-7-6-20-14-13(17)8-11(16)9-22-14/h2-5,8-9H,6-7,10H2,1H3,(H,20,22)(H2,18,21,23) |
| InChIKey | HLFOMNGNASJHBA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|