C16H26Cl2IN5O — CID 111391438
1-[3-(cyclopropylmethoxy)propyl]-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111391438) has the molecular formula C16H26Cl2IN5O and a molecular weight of 502.23 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111391438 |
| Molecular Formula | C16H26Cl2IN5O |
| Molecular Weight | 502.23 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCCNc1ncc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H25Cl2N5O.HI/c1-19-16(21-5-2-8-24-11-12-3-4-12)22-7-6-20-15-14(18)9-13(17)10-23-15;/h9-10,12H,2-8,11H2,1H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | YRNDOHXBJDURHI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|