C18H22Cl2N4O — CID 111192266
1-[3-(2,4-dichlorophenoxy)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192266) has the molecular formula C18H22Cl2N4O and a molecular weight of 381.31 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenoxy)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-[3-(2,4-dichlorophenoxy)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192266 |
| Molecular Formula | C18H22Cl2N4O |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[3-(2,4-dichlorophenoxy)propyl]-2-methyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCCOc1ccc(Cl)cc1Cl)NCCc1ccccn1 |
| InChI | InChI=1S/C18H22Cl2N4O/c1-21-18(24-11-8-15-5-2-3-9-22-15)23-10-4-12-25-17-7-6-14(19)13-16(17)20/h2-3,5-7,9,13H,4,8,10-12H2,1H3,(H2,21,23,24) |
| InChIKey | JGSILPBULKVKTI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|