C18H25ClIN5 — CID 111293586
1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111293586) has the molecular formula C18H25ClIN5 and a molecular weight of 473.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111293586 |
| Molecular Formula | C18H25ClIN5 |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[[2-(dimethylamino)-3-pyridinyl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N(C)C)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H24ClN5.HI/c1-20-18(24(4)13-14-7-9-16(19)10-8-14)22-12-15-6-5-11-21-17(15)23(2)3;/h5-11H,12-13H2,1-4H3,(H,20,22);1H |
| InChIKey | VBNWJIJKUNGUEX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|