C13H21ClIN3O — CID 111294068
1-[(4-chlorophenyl)methyl]-3-(2-methoxyethyl)-1,2-dimethylguanidine;hydroiodide (PubChem CID 111294068) has the molecular formula C13H21ClIN3O and a molecular weight of 397.69 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2-methoxyethyl)-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2-methoxyethyl)-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111294068 |
| Molecular Formula | C13H21ClIN3O |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2-methoxyethyl)-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C13H20ClN3O.HI/c1-15-13(16-8-9-18-3)17(2)10-11-4-6-12(14)7-5-11;/h4-7H,8-10H2,1-3H3,(H,15,16);1H |
| InChIKey | OKJCXJSUDUNBQX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|