C19H26ClIN4O2S — CID 111305342
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111305342) has the molecular formula C19H26ClIN4O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111305342 |
| Molecular Formula | C19H26ClIN4O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CS(=O)(=O)NC)cc1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C19H25ClN4O2S.HI/c1-21-19(24(3)13-17-5-4-6-18(20)11-17)23-12-15-7-9-16(10-8-15)14-27(25,26)22-2;/h4-11,22H,12-14H2,1-3H3,(H,21,23);1H |
| InChIKey | UGASVEBUUOZMKW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|