C19H25ClN4O2S — CID 111293629
1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111293629) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111293629 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(CS(=O)(=O)NC)cc1)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN4O2S/c1-21-19(24(3)13-16-8-10-18(20)11-9-16)23-12-15-4-6-17(7-5-15)14-27(25,26)22-2/h4-11,22H,12-14H2,1-3H3,(H,21,23) |
| InChIKey | VIOJLHNBEHRIRZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|