C13H14BrNO2 — CID 106953616
4-[(5-bromofuran-2-yl)methylamino]-2,5-dimethylphenol (PubChem CID 106953616) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 4-[(5-bromofuran-2-yl)methylamino]-2,5-dimethylphenol.
| Compound Name | 4-[(5-bromofuran-2-yl)methylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953616 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 4-[(5-bromofuran-2-yl)methylamino]-2,5-dimethylphenol |
| SMILES | Cc1cc(NCc2ccc(Br)o2)c(C)cc1O |
| InChI | InChI=1S/C13H14BrNO2/c1-8-6-12(16)9(2)5-11(8)15-7-10-3-4-13(14)17-10/h3-6,15-16H,7H2,1-2H3 |
| InChIKey | SIVMRSTVXQHQGR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|