C11H7Br2F2NO — CID 107609488
4-bromo-N-[(5-bromofuran-2-yl)methyl]-2,5-difluoroaniline (PubChem CID 107609488) has the molecular formula C11H7Br2F2NO and a molecular weight of 366.99 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromofuran-2-yl)methyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[(5-bromofuran-2-yl)methyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609488 |
| Molecular Formula | C11H7Br2F2NO |
| Molecular Weight | 366.99 g/mol |
| Exact Mass | 364.89 |
| IUPAC Name | 4-bromo-N-[(5-bromofuran-2-yl)methyl]-2,5-difluoroaniline |
| SMILES | Fc1cc(NCc2ccc(Br)o2)c(F)cc1Br |
| InChI | InChI=1S/C11H7Br2F2NO/c12-7-3-9(15)10(4-8(7)14)16-5-6-1-2-11(13)17-6/h1-4,16H,5H2 |
| InChIKey | DVFYNEMIHXVNIL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|