C13H12Br2N2O2 — CID 62085907
4-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbenzamide (PubChem CID 62085907) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is 4-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbenzamide.
| Compound Name | 4-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 62085907 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 4-[(4,5-dibromofuran-2-yl)methylamino]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C13H12Br2N2O2/c1-7-4-8(13(16)18)2-3-11(7)17-6-9-5-10(14)12(15)19-9/h2-5,17H,6H2,1H3,(H2,16,18) |
| InChIKey | VNIBVLDYRXXCOT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |