C18H24N6O3 — CID 10270615
3-[[6-(2,2-dimethylpropylamino)-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide (PubChem CID 10270615) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[[6-(2,2-dimethylpropylamino)-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide.
| Compound Name | 3-[[6-(2,2-dimethylpropylamino)-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 10270615 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[[6-(2,2-dimethylpropylamino)-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(Nc2ncnc(NCC(C)(C)C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N6O3/c1-11-6-7-12(17(25)19-5)8-13(11)23-16-14(24(26)27)15(21-10-22-16)20-9-18(2,3)4/h6-8,10H,9H2,1-5H3,(H,19,25)(H2,20,21,22,23) |
| InChIKey | AOXDYZRBOFGXEM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|