C20H28N6O5S — CID 58928536
3-[[6-[2,2-dimethylpropyl(methyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide (PubChem CID 58928536) has the molecular formula C20H28N6O5S and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-[[6-[2,2-dimethylpropyl(methyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide.
| Compound Name | 3-[[6-[2,2-dimethylpropyl(methyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 58928536 |
| Molecular Formula | C20H28N6O5S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-[[6-[2,2-dimethylpropyl(methyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(Nc2nc(S(C)(=O)=O)nc(N(C)CC(C)(C)C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H28N6O5S/c1-12-8-9-13(18(27)21-5)10-14(12)22-16-15(26(28)29)17(25(6)11-20(2,3)4)24-19(23-16)32(7,30)31/h8-10H,11H2,1-7H3,(H,21,27)(H,22,23,24) |
| InChIKey | MRDOGNAGJIUIPO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|