C13H17F4NO4S — CID 134938944
(7,7,7-trifluoro-5-fluorosulfonylheptyl) 1-methylpyrrole-2-carboxylate (PubChem CID 134938944) has the molecular formula C13H17F4NO4S and a molecular weight of 359.34 g/mol. Its IUPAC name is (7,7,7-trifluoro-5-fluorosulfonylheptyl) 1-methylpyrrole-2-carboxylate.
| Compound Name | (7,7,7-trifluoro-5-fluorosulfonylheptyl) 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134938944 |
| Molecular Formula | C13H17F4NO4S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (7,7,7-trifluoro-5-fluorosulfonylheptyl) 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCCCCC(CC(F)(F)F)S(=O)(=O)F |
| InChI | InChI=1S/C13H17F4NO4S/c1-18-7-4-6-11(18)12(19)22-8-3-2-5-10(23(17,20)21)9-13(14,15)16/h4,6-7,10H,2-3,5,8-9H2,1H3 |
| InChIKey | QDMBTUXSUZSQRZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|