C10H12F3NO2 — CID 114609419
propyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate (PubChem CID 114609419) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is propyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate.
| Compound Name | propyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 114609419 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | propyl 1-(2,2,2-trifluoroethyl)pyrrole-2-carboxylate |
| SMILES | CCCOC(=O)c1cccn1CC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2/c1-2-6-16-9(15)8-4-3-5-14(8)7-10(11,12)13/h3-5H,2,6-7H2,1H3 |
| InChIKey | CJYNDEQJUYTCQB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |