C9H13F3N4O3 — CID 79317372
ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]tetrazole-5-carboxylate (PubChem CID 79317372) has the molecular formula C9H13F3N4O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]tetrazole-5-carboxylate.
| Compound Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79317372 |
| Molecular Formula | C9H13F3N4O3 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | ethyl 1-[3-(2,2,2-trifluoroethoxy)propyl]tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4O3/c1-2-19-8(17)7-13-14-15-16(7)4-3-5-18-6-9(10,11)12/h2-6H2,1H3 |
| InChIKey | AGRQTTALFQGLDR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|