C10H18N4O2 — CID 79317604
ethyl 1-(3,3-dimethylbutyl)tetrazole-5-carboxylate (PubChem CID 79317604) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 1-(3,3-dimethylbutyl)tetrazole-5-carboxylate.
| Compound Name | ethyl 1-(3,3-dimethylbutyl)tetrazole-5-carboxylate |
|---|---|
| PubChem CID | 79317604 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | ethyl 1-(3,3-dimethylbutyl)tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1CCC(C)(C)C |
| InChI | InChI=1S/C10H18N4O2/c1-5-16-9(15)8-11-12-13-14(8)7-6-10(2,3)4/h5-7H2,1-4H3 |
| InChIKey | JIXRZGGBVPDKKH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |