C24H31NO3S — CID 143927612
tert-butyl 4-[3-[(4-methylsulfanylphenyl)methoxy]phenyl]piperidine-1-carboxylate (PubChem CID 143927612) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is tert-butyl 4-[3-[(4-methylsulfanylphenyl)methoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(4-methylsulfanylphenyl)methoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143927612 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl 4-[3-[(4-methylsulfanylphenyl)methoxy]phenyl]piperidine-1-carboxylate |
| SMILES | CSc1ccc(COc2cccc(C3CCN(C(=O)OC(C)(C)C)CC3)c2)cc1 |
| InChI | InChI=1S/C24H31NO3S/c1-24(2,3)28-23(26)25-14-12-19(13-15-25)20-6-5-7-21(16-20)27-17-18-8-10-22(29-4)11-9-18/h5-11,16,19H,12-15,17H2,1-4H3 |
| InChIKey | XWQDYEMOOKKLBF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |