C30H38N6O4 — CID 164907724
tert-butyl 4-[4-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]phenyl]piperidine-1-carboxylate (PubChem CID 164907724) has the molecular formula C30H38N6O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164907724 |
| Molecular Formula | C30H38N6O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | tert-butyl 4-[4-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]phenyl]piperidine-1-carboxylate |
| SMILES | CCCCc1cn(-c2ccc(C(=O)NNC(=O)c3ccc(C4CCN(C(=O)OC(C)(C)C)CC4)cc3)cc2)nn1 |
| InChI | InChI=1S/C30H38N6O4/c1-5-6-7-25-20-36(34-31-25)26-14-12-24(13-15-26)28(38)33-32-27(37)23-10-8-21(9-11-23)22-16-18-35(19-17-22)29(39)40-30(2,3)4/h8-15,20,22H,5-7,16-19H2,1-4H3,(H,32,37)(H,33,38) |
| InChIKey | ZDOXLZNMTDCGKQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|