C27H33N5O3 — CID 172786585
N'-[4-(4-butyltriazol-1-yl)benzoyl]-5-cyclohexyloxy-2-methylbenzohydrazide (PubChem CID 172786585) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is N'-[4-(4-butyltriazol-1-yl)benzoyl]-5-cyclohexyloxy-2-methylbenzohydrazide.
| Compound Name | N'-[4-(4-butyltriazol-1-yl)benzoyl]-5-cyclohexyloxy-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 172786585 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N'-[4-(4-butyltriazol-1-yl)benzoyl]-5-cyclohexyloxy-2-methylbenzohydrazide |
| SMILES | CCCCc1cn(-c2ccc(C(=O)NNC(=O)c3cc(OC4CCCCC4)ccc3C)cc2)nn1 |
| InChI | InChI=1S/C27H33N5O3/c1-3-4-8-21-18-32(31-28-21)22-14-12-20(13-15-22)26(33)29-30-27(34)25-17-24(16-11-19(25)2)35-23-9-6-5-7-10-23/h11-18,23H,3-10H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | OZAMYPGVKDKVFC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|