C20H22N6O4S — CID 164907756
3-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 164907756) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 3-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | 3-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 164907756 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[[[4-(4-butyltriazol-1-yl)benzoyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CCCCc1cn(-c2ccc(C(=O)NNC(=O)c3cccc(S(N)(=O)=O)c3)cc2)nn1 |
| InChI | InChI=1S/C20H22N6O4S/c1-2-3-6-16-13-26(25-22-16)17-10-8-14(9-11-17)19(27)23-24-20(28)15-5-4-7-18(12-15)31(21,29)30/h4-5,7-13H,2-3,6H2,1H3,(H,23,27)(H,24,28)(H2,21,29,30) |
| InChIKey | YBDYQTOXOVRCEQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|