C30H46N8O2 — CID 164907697
N'-[4-[amino-[(Z)-2-aminohex-1-enyl]amino]benzoyl]-4-(4-butyltriazol-1-yl)benzohydrazide;ethane (PubChem CID 164907697) has the molecular formula C30H46N8O2 and a molecular weight of 550.75 g/mol. Its IUPAC name is N'-[4-[amino-[(Z)-2-aminohex-1-enyl]amino]benzoyl]-4-(4-butyltriazol-1-yl)benzohydrazide;ethane.
| Compound Name | N'-[4-[amino-[(Z)-2-aminohex-1-enyl]amino]benzoyl]-4-(4-butyltriazol-1-yl)benzohydrazide;ethane |
|---|---|
| PubChem CID | 164907697 |
| Molecular Formula | C30H46N8O2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | N'-[4-[amino-[(Z)-2-aminohex-1-enyl]amino]benzoyl]-4-(4-butyltriazol-1-yl)benzohydrazide;ethane |
| SMILES | CC.CC.CCCC/C(N)=C/N(N)c1ccc(C(=O)NNC(=O)c2ccc(-n3cc(CCCC)nn3)cc2)cc1 |
| InChI | InChI=1S/C26H34N8O2.2C2H6/c1-3-5-7-21(27)17-33(28)23-13-9-19(10-14-23)25(35)30-31-26(36)20-11-15-24(16-12-20)34-18-22(29-32-34)8-6-4-2;2*1-2/h9-18H,3-8,27-28H2,1-2H3,(H,30,35)(H,31,36);2*1-2H3/b21-17-;; |
| InChIKey | OVZIQSAOKSYZBA-ZZTUKWCFSA-N |
| XLogP | 5.41 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|