C24H35N3O6 — CID 67844024
tert-butyl 4-[4-[[(6-methoxy-6-oxohexanoyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate (PubChem CID 67844024) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(6-methoxy-6-oxohexanoyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(6-methoxy-6-oxohexanoyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67844024 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | tert-butyl 4-[4-[[(6-methoxy-6-oxohexanoyl)amino]carbamoyl]phenyl]piperidine-1-carboxylate |
| SMILES | COC(=O)CCCCC(=O)NNC(=O)c1ccc(C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H35N3O6/c1-24(2,3)33-23(31)27-15-13-18(14-16-27)17-9-11-19(12-10-17)22(30)26-25-20(28)7-5-6-8-21(29)32-4/h9-12,18H,5-8,13-16H2,1-4H3,(H,25,28)(H,26,30) |
| InChIKey | GVZCQASXBXURJH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|