C21H29F3 — CID 19695503
1-butyl-4-[4-[(E)-5,5,5-trifluoropent-2-enyl]cyclohexyl]benzene (PubChem CID 19695503) has the molecular formula C21H29F3 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-butyl-4-[4-[(E)-5,5,5-trifluoropent-2-enyl]cyclohexyl]benzene.
| Compound Name | 1-butyl-4-[4-[(E)-5,5,5-trifluoropent-2-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19695503 |
| Molecular Formula | C21H29F3 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-butyl-4-[4-[(E)-5,5,5-trifluoropent-2-enyl]cyclohexyl]benzene |
| SMILES | CCCCc1ccc(C2CCC(C/C=C/CC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C21H29F3/c1-2-3-6-17-8-12-19(13-9-17)20-14-10-18(11-15-20)7-4-5-16-21(22,23)24/h4-5,8-9,12-13,18,20H,2-3,6-7,10-11,14-16H2,1H3/b5-4+ |
| InChIKey | IJOTZRBOVNVRLV-SNAWJCMRSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|