C12H14F2O2 — CID 145194546
4-cyclopropyl-1,2-difluorobenzene;ethyl formate (PubChem CID 145194546) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-cyclopropyl-1,2-difluorobenzene;ethyl formate.
| Compound Name | 4-cyclopropyl-1,2-difluorobenzene;ethyl formate |
|---|---|
| PubChem CID | 145194546 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-cyclopropyl-1,2-difluorobenzene;ethyl formate |
| SMILES | CCOC=O.Fc1ccc(C2CC2)cc1F |
| InChI | InChI=1S/C9H8F2.C3H6O2/c10-8-4-3-7(5-9(8)11)6-1-2-6;1-2-5-3-4/h3-6H,1-2H2;3H,2H2,1H3 |
| InChIKey | RKXRJNLUKNPGQP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|