C15H15F5O3 — CID 175215918
4-(3,4-difluorophenyl)cyclohexane-1-carbaldehyde;2,2,2-trifluoroacetic acid (PubChem CID 175215918) has the molecular formula C15H15F5O3 and a molecular weight of 338.27 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)cyclohexane-1-carbaldehyde;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(3,4-difluorophenyl)cyclohexane-1-carbaldehyde;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175215918 |
| Molecular Formula | C15H15F5O3 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-(3,4-difluorophenyl)cyclohexane-1-carbaldehyde;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=CC1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H14F2O.C2HF3O2/c14-12-6-5-11(7-13(12)15)10-3-1-9(8-16)2-4-10;3-2(4,5)1(6)7/h5-10H,1-4H2;(H,6,7) |
| InChIKey | ZILXFRMNIDLZNS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|