C15H15F6NO3 — CID 175204625
2,2,2-trifluoroacetic acid;4-[6-(trifluoromethyl)-3-pyridinyl]cyclohexane-1-carbaldehyde (PubChem CID 175204625) has the molecular formula C15H15F6NO3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;4-[6-(trifluoromethyl)-3-pyridinyl]cyclohexane-1-carbaldehyde.
| Compound Name | 2,2,2-trifluoroacetic acid;4-[6-(trifluoromethyl)-3-pyridinyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 175204625 |
| Molecular Formula | C15H15F6NO3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;4-[6-(trifluoromethyl)-3-pyridinyl]cyclohexane-1-carbaldehyde |
| SMILES | O=C(O)C(F)(F)F.O=CC1CCC(c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C13H14F3NO.C2HF3O2/c14-13(15,16)12-6-5-11(7-17-12)10-3-1-9(8-18)2-4-10;3-2(4,5)1(6)7/h5-10H,1-4H2;(H,6,7) |
| InChIKey | YEKPGZWZMXCYMS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|