C17H14F4N2 — CID 54401420
1-(3,4-difluorophenyl)-N-[(2,6-difluoro-4-propylphenyl)methylideneamino]methanimine (PubChem CID 54401420) has the molecular formula C17H14F4N2 and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-[(2,6-difluoro-4-propylphenyl)methylideneamino]methanimine.
| Compound Name | 1-(3,4-difluorophenyl)-N-[(2,6-difluoro-4-propylphenyl)methylideneamino]methanimine |
|---|---|
| PubChem CID | 54401420 |
| Molecular Formula | C17H14F4N2 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-[(2,6-difluoro-4-propylphenyl)methylideneamino]methanimine |
| SMILES | CCCc1cc(F)c(C=NN=Cc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C17H14F4N2/c1-2-3-11-6-15(19)13(16(20)7-11)10-23-22-9-12-4-5-14(18)17(21)8-12/h4-10H,2-3H2,1H3 |
| InChIKey | VNRYYTSPOFRUTJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|