C31H35FO — CID 20809203
(4aR,6R,8aR)-2-ethyl-6-[3-fluoro-4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809203) has the molecular formula C31H35FO and a molecular weight of 442.62 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-ethyl-6-[3-fluoro-4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-ethyl-6-[3-fluoro-4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809203 |
| Molecular Formula | C31H35FO |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (4aR,6R,8aR)-2-ethyl-6-[3-fluoro-4-(4-phenylmethoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OCc5ccccc5)cc4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H35FO/c1-2-22-8-9-26-19-27(11-10-25(26)18-22)28-14-17-30(31(32)20-28)24-12-15-29(16-13-24)33-21-23-6-4-3-5-7-23/h3-7,12-17,20,22,25-27H,2,8-11,18-19,21H2,1H3/t22?,25-,26-,27-/m1/s1 |
| InChIKey | DICICSBTGAZYEA-VHCQSIHGSA-N |
| XLogP | 8.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |