C19H28 — CID 56620245
(2R,4aR,8aR)-2-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 56620245) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 56620245 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (2R,4aR,8aR)-2-(4-propylphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCc1ccc([C@@H]2CC[C@H]3CCCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C19H28/c1-2-5-15-8-10-17(11-9-15)19-13-12-16-6-3-4-7-18(16)14-19/h8-11,16,18-19H,2-7,12-14H2,1H3/t16-,18-,19-/m1/s1 |
| InChIKey | TVVRKYBBVUJYOF-BHIYHBOVSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |