C29H46O — CID 71102889
4-[2-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]cyclohexan-1-ol (PubChem CID 71102889) has the molecular formula C29H46O and a molecular weight of 410.69 g/mol. Its IUPAC name is 4-[2-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]cyclohexan-1-ol.
| Compound Name | 4-[2-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 71102889 |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | 4-[2-[4-[4-[(2R)-2-phenylpropyl]cyclohexyl]cyclohexyl]ethyl]cyclohexan-1-ol |
| SMILES | C[C@H](CC1CCC(C2CCC(CCC3CCC(O)CC3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H46O/c1-22(26-5-3-2-4-6-26)21-25-11-17-28(18-12-25)27-15-9-23(10-16-27)7-8-24-13-19-29(30)20-14-24/h2-6,22-25,27-30H,7-21H2,1H3/t22-,23?,24?,25?,27?,28?,29?/m1/s1 |
| InChIKey | DZKFMEYJFJHURS-CHLXYZODSA-N |
| XLogP | 8.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |