C30H32F2O3 — CID 58698364
(4-ethoxy-3,5-difluorophenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate (PubChem CID 58698364) has the molecular formula C30H32F2O3 and a molecular weight of 478.58 g/mol. Its IUPAC name is (4-ethoxy-3,5-difluorophenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate.
| Compound Name | (4-ethoxy-3,5-difluorophenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58698364 |
| Molecular Formula | C30H32F2O3 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (4-ethoxy-3,5-difluorophenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate |
| SMILES | CCOc1c(F)cc(OC(=O)C2CCC(c3ccc(C[C@@H](C)c4ccccc4)cc3)CC2)cc1F |
| InChI | InChI=1S/C30H32F2O3/c1-3-34-29-27(31)18-26(19-28(29)32)35-30(33)25-15-13-24(14-16-25)23-11-9-21(10-12-23)17-20(2)22-7-5-4-6-8-22/h4-12,18-20,24-25H,3,13-17H2,1-2H3/t20-,24?,25?/m1/s1 |
| InChIKey | YFMRYGGDRIGSBW-NWSMCOELSA-N |
| XLogP | 7.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|