C33H38O2 — CID 21053086
[4-[(E)-pent-3-enyl]phenyl] 4-[4-(2-phenylpropyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 21053086) has the molecular formula C33H38O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is [4-[(E)-pent-3-enyl]phenyl] 4-[4-(2-phenylpropyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-pent-3-enyl]phenyl] 4-[4-(2-phenylpropyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21053086 |
| Molecular Formula | C33H38O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [4-[(E)-pent-3-enyl]phenyl] 4-[4-(2-phenylpropyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(OC(=O)C2CCC(c3ccc(CC(C)c4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H38O2/c1-3-4-6-9-26-14-22-32(23-15-26)35-33(34)31-20-18-30(19-21-31)29-16-12-27(13-17-29)24-25(2)28-10-7-5-8-11-28/h3-5,7-8,10-17,22-23,25,30-31H,6,9,18-21,24H2,1-2H3/b4-3+ |
| InChIKey | URNFHSZSLISMCE-ONEGZZNKSA-N |
| XLogP | 8.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|