C31H34F2O2 — CID 58698280
(3,5-difluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate (PubChem CID 58698280) has the molecular formula C31H34F2O2 and a molecular weight of 476.61 g/mol. Its IUPAC name is (3,5-difluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate.
| Compound Name | (3,5-difluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58698280 |
| Molecular Formula | C31H34F2O2 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (3,5-difluoro-4-propylphenyl) 4-[4-[(2R)-2-phenylpropyl]phenyl]cyclohexane-1-carboxylate |
| SMILES | CCCc1c(F)cc(OC(=O)C2CCC(c3ccc(C[C@@H](C)c4ccccc4)cc3)CC2)cc1F |
| InChI | InChI=1S/C31H34F2O2/c1-3-7-28-29(32)19-27(20-30(28)33)35-31(34)26-16-14-25(15-17-26)24-12-10-22(11-13-24)18-21(2)23-8-5-4-6-9-23/h4-6,8-13,19-21,25-26H,3,7,14-18H2,1-2H3/t21-,25?,26?/m1/s1 |
| InChIKey | TVEYRAFSXXEWGQ-ZUOMXFFYSA-N |
| XLogP | 8.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|