C36H43FO2 — CID 59870187
(3-fluoro-4-propylphenyl) 4-[(Z)-4-[4-(4-butylcyclohexyl)phenyl]but-2-enyl]benzoate (PubChem CID 59870187) has the molecular formula C36H43FO2 and a molecular weight of 526.74 g/mol. Its IUPAC name is (3-fluoro-4-propylphenyl) 4-[(Z)-4-[4-(4-butylcyclohexyl)phenyl]but-2-enyl]benzoate.
| Compound Name | (3-fluoro-4-propylphenyl) 4-[(Z)-4-[4-(4-butylcyclohexyl)phenyl]but-2-enyl]benzoate |
|---|---|
| PubChem CID | 59870187 |
| Molecular Formula | C36H43FO2 |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | (3-fluoro-4-propylphenyl) 4-[(Z)-4-[4-(4-butylcyclohexyl)phenyl]but-2-enyl]benzoate |
| SMILES | CCCCC1CCC(c2ccc(C/C=C\Cc3ccc(C(=O)Oc4ccc(CCC)c(F)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C36H43FO2/c1-3-5-9-27-12-18-30(19-13-27)31-20-14-28(15-21-31)10-6-7-11-29-16-22-33(23-17-29)36(38)39-34-25-24-32(8-4-2)35(37)26-34/h6-7,14-17,20-27,30H,3-5,8-13,18-19H2,1-2H3/b7-6- |
| InChIKey | HKHUBPGDNNDDLT-SREVYHEPSA-N |
| XLogP | 9.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|