C24H31NO — CID 3577393
N-(1-phenylethyl)-4-(4-propylcyclohexyl)benzamide (PubChem CID 3577393) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is N-(1-phenylethyl)-4-(4-propylcyclohexyl)benzamide.
| Compound Name | N-(1-phenylethyl)-4-(4-propylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 3577393 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-(1-phenylethyl)-4-(4-propylcyclohexyl)benzamide |
| SMILES | CCCC1CCC(c2ccc(C(=O)NC(C)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H31NO/c1-3-7-19-10-12-21(13-11-19)22-14-16-23(17-15-22)24(26)25-18(2)20-8-5-4-6-9-20/h4-6,8-9,14-19,21H,3,7,10-13H2,1-2H3,(H,25,26) |
| InChIKey | IHZMZBPXOJHONR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |