C25H41NO2 — CID 67692918
4-(4-heptylcyclohexyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide (PubChem CID 67692918) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 4-(4-heptylcyclohexyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide.
| Compound Name | 4-(4-heptylcyclohexyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 67692918 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 4-(4-heptylcyclohexyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzamide |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)N[C@H](CO)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H41NO2/c1-4-5-6-7-8-9-20-10-12-21(13-11-20)22-14-16-23(17-15-22)25(28)26-24(18-27)19(2)3/h14-17,19-21,24,27H,4-13,18H2,1-3H3,(H,26,28)/t20?,21?,24-/m1/s1 |
| InChIKey | HAIPAHIHHLDEEQ-SLXFGWRHSA-N |
| XLogP | 6.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|