C26H37N3O — CID 90266417
N-(2,4-diaminophenyl)-4-(4-heptylcyclohexyl)benzamide (PubChem CID 90266417) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is N-(2,4-diaminophenyl)-4-(4-heptylcyclohexyl)benzamide.
| Compound Name | N-(2,4-diaminophenyl)-4-(4-heptylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 90266417 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-(2,4-diaminophenyl)-4-(4-heptylcyclohexyl)benzamide |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)Nc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C26H37N3O/c1-2-3-4-5-6-7-19-8-10-20(11-9-19)21-12-14-22(15-13-21)26(30)29-25-17-16-23(27)18-24(25)28/h12-20H,2-11,27-28H2,1H3,(H,29,30) |
| InChIKey | XCBQRRCRLMLTMH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|