C29H46N2O4 — CID 92654645
methyl (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[4-(4-pentylcyclohexyl)benzoyl]amino]butanoyl]amino]butanoate (PubChem CID 92654645) has the molecular formula C29H46N2O4 and a molecular weight of 486.70 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[4-(4-pentylcyclohexyl)benzoyl]amino]butanoyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[4-(4-pentylcyclohexyl)benzoyl]amino]butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 92654645 |
| Molecular Formula | C29H46N2O4 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(2S)-3-methyl-2-[[4-(4-pentylcyclohexyl)benzoyl]amino]butanoyl]amino]butanoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)N[C@H](C(=O)N[C@H](C(=O)OC)C(C)C)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C29H46N2O4/c1-7-8-9-10-21-11-13-22(14-12-21)23-15-17-24(18-16-23)27(32)30-25(19(2)3)28(33)31-26(20(4)5)29(34)35-6/h15-22,25-26H,7-14H2,1-6H3,(H,30,32)(H,31,33)/t21?,22?,25-,26-/m0/s1 |
| InChIKey | FMJFUTFPOKEUDQ-TZYVOJFLSA-N |
| XLogP | 5.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|