C25H30F2O — CID 138459500
1-ethoxy-2-fluoro-4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene (PubChem CID 138459500) has the molecular formula C25H30F2O and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 138459500 |
| Molecular Formula | C25H30F2O |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[2-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]benzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(OCC)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H30F2O/c1-3-5-6-7-18-8-10-19(11-9-18)20-12-14-22(23(26)16-20)21-13-15-25(28-4-2)24(27)17-21/h3,5,12-19H,4,6-11H2,1-2H3/b5-3+ |
| InChIKey | XTEIOXVMULITPG-HWKANZROSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|