C25H28F4O — CID 139983621
2-fluoro-4-[4-(4-propylcyclohexyl)phenyl]-1-[(E)-4,4,4-trifluorobut-2-enoxy]benzene (PubChem CID 139983621) has the molecular formula C25H28F4O and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-propylcyclohexyl)phenyl]-1-[(E)-4,4,4-trifluorobut-2-enoxy]benzene.
| Compound Name | 2-fluoro-4-[4-(4-propylcyclohexyl)phenyl]-1-[(E)-4,4,4-trifluorobut-2-enoxy]benzene |
|---|---|
| PubChem CID | 139983621 |
| Molecular Formula | C25H28F4O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-fluoro-4-[4-(4-propylcyclohexyl)phenyl]-1-[(E)-4,4,4-trifluorobut-2-enoxy]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(OC/C=C/C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H28F4O/c1-2-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)22-13-14-24(23(26)17-22)30-16-3-15-25(27,28)29/h3,9-15,17-19H,2,4-8,16H2,1H3/b15-3+ |
| InChIKey | BSNMQOJDIGXIGK-CRKCGEKBSA-N |
| XLogP | 8.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|