C15H17BrClF3 — CID 22913654
4-[4-(2-bromoethyl)cyclohexyl]-1-[chloro(difluoro)methyl]-2-fluorobenzene (PubChem CID 22913654) has the molecular formula C15H17BrClF3 and a molecular weight of 369.65 g/mol. Its IUPAC name is 4-[4-(2-bromoethyl)cyclohexyl]-1-[chloro(difluoro)methyl]-2-fluorobenzene.
| Compound Name | 4-[4-(2-bromoethyl)cyclohexyl]-1-[chloro(difluoro)methyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 22913654 |
| Molecular Formula | C15H17BrClF3 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 4-[4-(2-bromoethyl)cyclohexyl]-1-[chloro(difluoro)methyl]-2-fluorobenzene |
| SMILES | Fc1cc(C2CCC(CCBr)CC2)ccc1C(F)(F)Cl |
| InChI | InChI=1S/C15H17BrClF3/c16-8-7-10-1-3-11(4-2-10)12-5-6-13(14(18)9-12)15(17,19)20/h5-6,9-11H,1-4,7-8H2 |
| InChIKey | AFMYRMKDVTUUKL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|