C17H20BrF3O — CID 22913905
4-[4-(3-bromopropyl)cyclohexyl]-1-(2,2-difluoroethenoxy)-2-fluorobenzene (PubChem CID 22913905) has the molecular formula C17H20BrF3O and a molecular weight of 377.24 g/mol. Its IUPAC name is 4-[4-(3-bromopropyl)cyclohexyl]-1-(2,2-difluoroethenoxy)-2-fluorobenzene.
| Compound Name | 4-[4-(3-bromopropyl)cyclohexyl]-1-(2,2-difluoroethenoxy)-2-fluorobenzene |
|---|---|
| PubChem CID | 22913905 |
| Molecular Formula | C17H20BrF3O |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-[4-(3-bromopropyl)cyclohexyl]-1-(2,2-difluoroethenoxy)-2-fluorobenzene |
| SMILES | FC(F)=COc1ccc(C2CCC(CCCBr)CC2)cc1F |
| InChI | InChI=1S/C17H20BrF3O/c18-9-1-2-12-3-5-13(6-4-12)14-7-8-16(15(19)10-14)22-11-17(20)21/h7-8,10-13H,1-6,9H2 |
| InChIKey | LEZAICFNZZUROY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|