C22H23F2NO — CID 58782892
2-fluoro-4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-6-hydroxybenzonitrile (PubChem CID 58782892) has the molecular formula C22H23F2NO and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-fluoro-4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-6-hydroxybenzonitrile.
| Compound Name | 2-fluoro-4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-6-hydroxybenzonitrile |
|---|---|
| PubChem CID | 58782892 |
| Molecular Formula | C22H23F2NO |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-fluoro-4-[2-fluoro-4-(4-propylcyclohexyl)phenyl]-6-hydroxybenzonitrile |
| SMILES | CCCC1CCC(c2ccc(-c3cc(O)c(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C22H23F2NO/c1-2-3-14-4-6-15(7-5-14)16-8-9-18(20(23)10-16)17-11-21(24)19(13-25)22(26)12-17/h8-12,14-15,26H,2-7H2,1H3 |
| InChIKey | PNDUACFPBDXMAI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |